Identita
Hydroxy Macitentan
CAS 2365406-85-3 · C13H15BrN4O3S
01Identita
| Lazychem ID | LC-16717 |
|---|---|
| CAS RN | 2365406-85-3 |
| PubChem CID | 137157140 |
| Molecular formula | C13H15BrN4O3S |
| Molecular weight | 387.25 g/mol |
| IUPAC name | N-[5-(4-Bromophenyl)-6-hydroxy-4-pyrimidinyl]-N'-propylsulfamide |
| InChIKey | ULDLQFSOWJYBCO-UHFFFAOYSA-N |
02Struktura a stereochemie
2D structurePubChem CID 137157140

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CCCNS(=O)(=O)NC1=C(C(=O)NC=N1)C2=CC=C(C=C2)Br |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Macitentan
Nečistoty a související sloučeninyNázvy a vztahy
- 5-(4-bromophenyl)-4-(propylsulfamoylamino)-1H-pyrimidin-6-one
- 2365406-85-3
- SCHEMBL18419706
- 5-(p-Bromophenyl)-6-(propylaminosulfonylamino)-4-pyrimidinol
05Zdroje
- S01PubChem CID 137157140
Structure and machine-readable chemical identifiers.
