Identita
SB 415286
Neuvedeno · C16H10ClN3O5
01Identita
| Lazychem ID | LC-87406 |
|---|---|
| CAS RN | Neuvedeno |
| PubChem CID | 4210951 |
| Molecular formula | C16H10ClN3O5 |
| Molecular weight | 359.72 g/mol |
| IUPAC name | 3-(3-chloro-4-hydroxyanilino)-4-(2-nitrophenyl)pyrrole-2,5-dione |
| InChIKey | PQCXVIPXISBFPN-UHFFFAOYSA-N |
02Struktura a stereochemie
2D structurePubChem CID 4210951

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 1 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C(=C1)C2=C(C(=O)NC2=O)NC3=CC(=C(C=C3)O)Cl)[N+](=O)[O-] |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Neuvedeno
Názvy a vztahy
05Zdroje
- S01PubChem CID 4210951
Structure and machine-readable chemical identifiers.
