Identita
2,4-Dihydroxy-5-nitrobenzoic acid
Neuvedeno · C7H5NO6
01Identita
| Lazychem ID | LC-70089 |
|---|---|
| CAS RN | Neuvedeno |
| PubChem CID | 16637915 |
| Molecular formula | C7H5NO6 |
| Molecular weight | 199.12 g/mol |
| IUPAC name | 2,4-dihydroxy-5-nitrobenzoic acid |
| InChIKey | DVHFWKCHUQZGSF-UHFFFAOYSA-N |
02Struktura a stereochemie
2D structurePubChem CID 16637915

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])O)O)C(=O)O |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Neuvedeno
Názvy a vztahy
05Zdroje
- S01PubChem CID 16637915
Structure and machine-readable chemical identifiers.
