Identita
Metronidazole Phosphate
Neuvedeno · C6H10N3O6P
01Identita
| Lazychem ID | LC-53510 |
|---|---|
| CAS RN | Neuvedeno |
| PubChem CID | 51794 |
| Molecular formula | C6H10N3O6P |
| Molecular weight | 251.13 g/mol |
| IUPAC name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl dihydrogen phosphate |
| InChIKey | GFFOAZOYBIIJHI-UHFFFAOYSA-N |
02Struktura a stereochemie
2D structurePubChem CID 51794

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=NC=C(N1CCOP(=O)(O)O)[N+](=O)[O-] |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Neuvedeno
Názvy a vztahy
05Zdroje
- S01PubChem CID 51794
Structure and machine-readable chemical identifiers.
