Identita
3-Nitro-4-phenoxybenzoic acid
Neuvedeno · C13H9NO5
01Identita
| Lazychem ID | LC-43328 |
|---|---|
| CAS RN | Neuvedeno |
| PubChem CID | 16795269 |
| Molecular formula | C13H9NO5 |
| Molecular weight | 259.21 g/mol |
| IUPAC name | 3-nitro-4-phenoxybenzoic acid |
| InChIKey | ATDCOBLVFMERLI-UHFFFAOYSA-N |
02Struktura a stereochemie
2D structurePubChem CID 16795269

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Neuvedeno
Názvy a vztahy
05Zdroje
- S01PubChem CID 16795269
Structure and machine-readable chemical identifiers.
