Identita
Cabozantinib oxidation B
Neuvedeno · C28H24FN3O6
01Identita
| Lazychem ID | LC-37299 |
|---|---|
| CAS RN | Neuvedeno |
| PubChem CID | 86269463 |
| Molecular formula | C28H24FN3O6 |
| Molecular weight | 517.5 g/mol |
| IUPAC name | 1-N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(4-fluoro-2-hydroxyphenyl)cyclopropane-1,1-dicarboxamide |
| InChIKey | IMBCTWUTGHKFAD-UHFFFAOYSA-N |
02Struktura a stereochemie
2D structurePubChem CID 86269463

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=CC2=C(C=CN=C2C=C1OC)OC3=CC=C(C=C3)NC(=O)C4(CC4)C(=O)NC5=C(C=C(C=C5)F)O |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Neuvedeno
Názvy a vztahy
05Zdroje
- S01PubChem CID 86269463
Structure and machine-readable chemical identifiers.
