Identita
Cromoglicic acid
CAS 16110-51-3 · C23H16O11
01Identita
| Lazychem ID | LC-100870 |
|---|---|
| CAS RN | 16110-51-3 |
| PubChem CID | 2882 |
| Molecular formula | C23H16O11 |
| Molecular weight | 468.4 g/mol |
| IUPAC name | 5-[3-(2-carboxy-4-oxochromen-5-yl)oxy-2-hydroxypropoxy]-4-oxochromene-2-carboxylic acid |
| InChIKey | IMZMKUWMOSJXDT-UHFFFAOYSA-N |
02Struktura a stereochemie
2D structurePubChem CID 2882

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC2=C(C(=C1)OCC(COC3=CC=CC4=C3C(=O)C=C(O4)C(=O)O)O)C(=O)C=C(O2)C(=O)O |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Neuvedeno
Názvy a vztahy
- cromolyn
- Cromoglicic acid
- 16110-51-3
- Cromoglycic acid
- Cromoglicate
- Acido cromoglicico
- Acide cromoglicique
- Acidum cromoglicicum
- Cromo-Comod
- Y0TK0FS77W
- 5-[3-(2-carboxy-4-oxochromen-5-yl)oxy-2-hydroxypropoxy]-4-oxochromene-2-carboxylic acid
- R03BC01
05Zdroje
- S01PubChem CID 2882
Structure and machine-readable chemical identifiers.
