Identita
2-Nitroso Clonidine
Neuvedeno · C9H8Cl2N4O
01Identita
| Lazychem ID | LC-02077 |
|---|---|
| CAS RN | Neuvedeno |
| PubChem CID | 176480781 |
| Molecular formula | C9H8Cl2N4O |
| Molecular weight | 259.09 g/mol |
| IUPAC name | N-(2,6-dichlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)nitrous amide |
| InChIKey | STCAJPPTIXXWKA-UHFFFAOYSA-N |
02Struktura a stereochemie
2D structurePubChem CID 176480781

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom, contains an N-nitroso substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 1 |
| Tertiary amines | 1 |
| SMILES | ClC1=C(N(C2=NCCN2)N=O)C(Cl)=CC=C1 |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Clonidine
Nečistoty a související sloučeninyNázvy a vztahy
- N-Nitroso Moxifloxacin Impurity 7
- Mono Nitroso Pyrrolopiperidine
- 1-Nitroso-pyrrolopiperidine
05Zdroje
- S01PubChem CID 176480781
Structure and machine-readable chemical identifiers.
