Identita
3-Hydroxy-4-methoxycinnamic Acid
CAS 537-73-5 · C10H10O4
01Identita
| Lazychem ID | LC-02577 |
|---|---|
| CAS RN | 537-73-5 |
| PubChem CID | 736186 |
| Molecular formula | C10H10O4 |
| Molecular weight | 194.18 g/mol |
| IUPAC name | 3-Hydroxy-4-methoxycinnamic Acid |
| InChIKey | QURCVMIEKCOAJU-HWKANZROSA-N |
02Struktura a stereochemie
2D structurePubChem CID 736186

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=C(O)C=C(/C=C/C(O)=O)C=C1 |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Cinnamic acid
Nečistoty a související sloučeninyNázvy a vztahy
- Isoferulic acid
- 3-(3-Hydroxy-4-methoxyphenyl)acrylic acid
- (E)-3-(3-hydroxy-4-methoxyphenyl)acrylic acid
- 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoic acid
05Zdroje
- S01PubChem CID 736186
Structure and machine-readable chemical identifiers.
