Identita
Chlorprothixene EP Impurity E (Free Base)
CAS 86-39-5 · C13H7ClOS
01Identita
| Lazychem ID | LC-31580 |
|---|---|
| CAS RN | 86-39-5 |
| PubChem CID | 618848 |
| Molecular formula | C13H7ClOS |
| Molecular weight | 246.7 g/mol |
| IUPAC name | 2-chloro-9H-thioxanthen-9-one |
| InChIKey | ZCDADJXRUCOCJE-UHFFFAOYSA-N |
02Struktura a stereochemie
2D structurePubChem CID 618848

The parsed structure contains 3 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | O=C1C2=C(SC3=C1C=CC=C3)C=CC(Cl)=C2 |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Chlorprothixene
Nečistoty a související sloučeninyNázvy a vztahy
- 2-Chlorothioxanthen-9-one
- 2-Chlorothioxanthone
05Zdroje
- S01PubChem CID 618848
Structure and machine-readable chemical identifiers.
