Identita
Acetovanillone D3
CAS 80404-23-5 · C9H7D3O3
01Identita
| Lazychem ID | LC-04786 |
|---|---|
| CAS RN | 80404-23-5 |
| PubChem CID | 12268985 |
| Molecular formula | C9H7D3O3 |
| Molecular weight | 169.2 g/mol |
| IUPAC name | 1-(4-Hydroxy-3-(methoxy-d3)phenyl)ethan-1-one |
| InChIKey | DFYRUELUNQRZTB-BMSJAHLVSA-N |
02Struktura a stereochemie
2D structurePubChem CID 12268985

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(C1=CC=C(O)C(OC([2H])([2H])[2H])=C1)=O |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Acetovanillone
Nečistoty a související sloučeninyNázvy a vztahy
- Acetoguaiacon-d3
- Apocynine-d3
- 1-(4-Hydroxy-3-methoxyphenyl)ethanone-d3
05Zdroje
- S01PubChem CID 12268985
Structure and machine-readable chemical identifiers.
