Идентичност
Ospemifene
Не е посочено · C24H23ClO2
01Идентичност
| Lazychem ID | LC-89823 |
|---|---|
| CAS RN | Не е посочено |
| PubChem CID | 3036505 |
| Molecular formula | C24H23ClO2 |
| Molecular weight | 378.9 g/mol |
| IUPAC name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol |
| InChIKey | LUMKNAVTFCDUIE-VHXPQNKSSA-N |
02Структура и стереохимия
2D structurePubChem CID 3036505

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C=C1)/C(=C(/C2=CC=CC=C2)\C3=CC=C(C=C3)OCCO)/CCCl |
|---|---|
| InChI | Не е посочено |
03Статус в Индия
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Имена и връзки
API и изходно лекарство
Не е посочено
Имена и връзки
05Източници
- S01PubChem CID 3036505
Structure and machine-readable chemical identifiers.
