Идентичност
Morusin
Не е посочено · C25H24O6
01Идентичност
| Lazychem ID | LC-85624 |
|---|---|
| CAS RN | Не е посочено |
| PubChem CID | 5281671 |
| Molecular formula | C25H24O6 |
| Molecular weight | 420.5 g/mol |
| IUPAC name | 2-(2,4-dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methylbut-2-enyl)pyrano[2,3-h]chromen-4-one |
| InChIKey | XFFOMNJIDRDDLQ-UHFFFAOYSA-N |
02Структура и стереохимия
2D structurePubChem CID 5281671

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(=CCC1=C(OC2=C(C1=O)C(=CC3=C2C=CC(O3)(C)C)O)C4=C(C=C(C=C4)O)O)C |
|---|---|
| InChI | Не е посочено |
03Статус в Индия
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Имена и връзки
API и изходно лекарство
Не е посочено
Имена и връзки
05Източници
- S01PubChem CID 5281671
Structure and machine-readable chemical identifiers.
