Идентичност
Adjudin
Не е посочено · C15H12Cl2N4O
01Идентичност
| Lazychem ID | LC-82002 |
|---|---|
| CAS RN | Не е посочено |
| PubChem CID | 9819086 |
| Molecular formula | C15H12Cl2N4O |
| Molecular weight | 335.2 g/mol |
| IUPAC name | 1-[(2,4-dichlorophenyl)methyl]indazole-3-carbohydrazide |
| InChIKey | VENCPJAAXKBIJD-UHFFFAOYSA-N |
02Структура и стереохимия
2D structurePubChem CID 9819086
The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C2C(=C1)C(=NN2CC3=C(C=C(C=C3)Cl)Cl)C(=O)NN |
|---|---|
| InChI | Не е посочено |
03Статус в Индия
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Имена и връзки
API и изходно лекарство
Не е посочено
Имена и връзки
05Източници
- S01PubChem CID 9819086
Structure and machine-readable chemical identifiers.