Идентичност
SCH-202676 hydrobromide
Не е посочено · C15H14BrN3S
01Идентичност
| Lazychem ID | LC-76185 |
|---|---|
| CAS RN | Не е посочено |
| PubChem CID | 11957689 |
| Molecular formula | C15H14BrN3S |
| Molecular weight | 348.3 g/mol |
| IUPAC name | N-methyl-2,3-diphenyl-1,2,4-thiadiazol-5-imine;hydrobromide |
| InChIKey | YJYGOWVFDGULLL-UHFFFAOYSA-N |
02Структура и стереохимия
2D structurePubChem CID 11957689

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CN=C1N=C(N(S1)C2=CC=CC=C2)C3=CC=CC=C3.Br |
|---|---|
| InChI | Не е посочено |
03Статус в Индия
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Имена и връзки
API и изходно лекарство
Не е посочено
Имена и връзки
05Източници
- S01PubChem CID 11957689
Structure and machine-readable chemical identifiers.
