Идентичност
3-Bromocinnoline
Не е посочено · C8H5BrN2
01Идентичност
| Lazychem ID | LC-74630 |
|---|---|
| CAS RN | Не е посочено |
| PubChem CID | 12678051 |
| Molecular formula | C8H5BrN2 |
| Molecular weight | 209.04 g/mol |
| IUPAC name | 3-bromocinnoline |
| InChIKey | MEYRUXMLXSGXKP-UHFFFAOYSA-N |
02Структура и стереохимия
2D structurePubChem CID 12678051

The parsed structure contains 2 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C2C(=C1)C=C(N=N2)Br |
|---|---|
| InChI | Не е посочено |
03Статус в Индия
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Имена и връзки
API и изходно лекарство
Не е посочено
Имена и връзки
05Източници
- S01PubChem CID 12678051
Structure and machine-readable chemical identifiers.
