Идентичност
Bay-876
Не е посочено · C24H16F4N6O2
01Идентичност
| Lazychem ID | LC-55385 |
|---|---|
| CAS RN | Не е посочено |
| PubChem CID | 118191391 |
| Molecular formula | C24H16F4N6O2 |
| Molecular weight | 496.4 g/mol |
| IUPAC name | 4-N-[1-[(4-cyanophenyl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-yl]-7-fluoroquinoline-2,4-dicarboxamide |
| InChIKey | BKLJDIJJOOQUFG-UHFFFAOYSA-N |
02Структура и стереохимия
2D structurePubChem CID 118191391
The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=C(C(=NN1CC2=CC=C(C=C2)C#N)C(F)(F)F)NC(=O)C3=CC(=NC4=C3C=CC(=C4)F)C(=O)N |
|---|---|
| InChI | Не е посочено |
03Статус в Индия
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Имена и връзки
API и изходно лекарство
Не е посочено
Имена и връзки
05Източници
- S01PubChem CID 118191391
Structure and machine-readable chemical identifiers.