Идентичност
Anagrelide
Не е посочено · C10H7Cl2N3O
01Идентичност
| Lazychem ID | LC-55227 |
|---|---|
| CAS RN | Не е посочено |
| PubChem CID | 135409400 |
| Molecular formula | C10H7Cl2N3O |
| Molecular weight | 256.08 g/mol |
| IUPAC name | 6,7-dichloro-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
| InChIKey | OTBXOEAOVRKTNQ-UHFFFAOYSA-N |
02Структура и стереохимия
2D structurePubChem CID 135409400

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | C1C2=C(C=CC(=C2Cl)Cl)N=C3N1CC(=O)N3 |
|---|---|
| InChI | Не е посочено |
03Статус в Индия
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Имена и връзки
API и изходно лекарство
Не е посочено
Имена и връзки
05Източници
- S01PubChem CID 135409400
Structure and machine-readable chemical identifiers.
