Идентичност
Caffeidine acid
Не е посочено · C8H12N4O3
01Идентичност
| Lazychem ID | LC-52094 |
|---|---|
| CAS RN | Не е посочено |
| PubChem CID | 126542 |
| Molecular formula | C8H12N4O3 |
| Molecular weight | 212.21 g/mol |
| IUPAC name | 3-methyl-5-[methyl(methylcarbamoyl)amino]imidazole-4-carboxylic acid |
| InChIKey | KCDXKHFRZVPYRR-UHFFFAOYSA-N |
02Структура и стереохимия
2D structurePubChem CID 126542

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CNC(=O)N(C)C1=C(N(C=N1)C)C(=O)O |
|---|---|
| InChI | Не е посочено |
03Статус в Индия
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Имена и връзки
API и изходно лекарство
Не е посочено
Имена и връзки
05Източници
- S01PubChem CID 126542
Structure and machine-readable chemical identifiers.
