Идентичност
Milrinone Impurity W
Не е посочено · C12H9N3O
01Идентичност
| Lazychem ID | LC-44908 |
|---|---|
| CAS RN | Не е посочено |
| PubChem CID | 13060621 |
| Molecular formula | C12H9N3O |
| Molecular weight | 211.22 g/mol |
| IUPAC name | 6-methyl-2-oxo-5-pyridin-3-yl-1H-pyridine-3-carbonitrile |
| InChIKey | HFXSLWPMSHEBFJ-UHFFFAOYSA-N |
02Структура и стереохимия
2D structurePubChem CID 13060621

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=C(C=C(C(=O)N1)C#N)C2=CN=CC=C2 |
|---|---|
| InChI | Не е посочено |
03Статус в Индия
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Имена и връзки
API и изходно лекарство
Не е посочено
Имена и връзки
05Източници
- S01PubChem CID 13060621
Structure and machine-readable chemical identifiers.
